CAS 398-69-6
:Benzenediazonium, 2,5-dichloro-, tetrafluoroborate(1-) (1:1)
Description:
Benzenediazonium, 2,5-dichloro-, tetrafluoroborate(1-) (1:1), commonly referred to as 2,5-dichlorobenzenediazonium tetrafluoroborate, is an organic compound characterized by its diazonium functional group, which is known for its reactivity in electrophilic aromatic substitution reactions. This compound features a benzene ring substituted with two chlorine atoms at the 2 and 5 positions, enhancing its electrophilic properties. The tetrafluoroborate anion (BF4-) serves as a stable counterion, contributing to the overall stability of the compound in solution. Benzenediazonium salts are typically sensitive to heat and light, and they can decompose to release nitrogen gas, making them useful in various synthetic applications, including azo dye production. The presence of chlorine substituents can influence the reactivity and selectivity of subsequent reactions, allowing for the introduction of diverse functional groups onto the aromatic ring. As with many diazonium compounds, safety precautions are essential due to their potential hazards, including toxicity and explosive decomposition under certain conditions.
Formula:C6H3Cl2N2·BF4
InChI:InChI=1S/C6H3Cl2N2.BF4/c7-4-1-2-5(8)6(3-4)10-9;2-1(3,4)5/h1-3H;/q+1;-1
InChI key:InChIKey=WGFJSVKFPRUHOG-UHFFFAOYSA-N
SMILES:[N+](#N)C1=C(Cl)C=CC(Cl)=C1.[B+3]([F-])([F-])([F-])[F-]
Synonyms:- 2,5-Dichlorobenzenediazonium
- 2,5-Dichlorobenzenediazonium fluoborate
- 2,5-Dichlorobenzenediazonium fluoroborate
- 2,5-Dichlorophenyldiazonium tetrafluoroborate
- Benzenediazonium, 2,5-dichloro-, tetrafluoroborate(1-)
- Benzenediazonium, 2,5-dichloro-, tetrafluoroborate(1-) (1:1)
- Borate(1-), tetrafluoro-, 2,5-dichlorobenzenediazonium
- Boron(+3) Cation
- Tetrafluoride
- 2,5-Dichlorobenzenediazonium tetrafluoroborate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.