CAS 39802-78-3

2'-Chlorobiphenyl-4-carbaldehyde

Description:

2'-Chlorobiphenyl-4-carbaldehyde, with the CAS number 39802-78-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 2' position and an aldehyde functional group (-CHO) at the 4-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The chlorine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions, while the aldehyde group can participate in various condensation reactions. Additionally, 2'-Chlorobiphenyl-4-carbaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. As with many chlorinated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₁₃H₉ClO

InChI: InChI=1/C13H9ClO/c14-13-4-2-1-3-12(13)11-7-5-10(9-15)6-8-11/h1-9H

SMILES: c1ccc(c(c1)c1ccc(cc1)C=O)Cl

Synonyms:

• 2'-Chloro-[1,1'-biphenyl]-4-carboxaldehyde

2'-Chloro-[1,1'-biphenyl]-4-carbaldehyde

CAS: 39802-78-3

Formula: C₁₃H₉ClO

Purity: 99%

Molecular weight: 216.6630

Ref: IN-DA007780

2'-Chloro-[1,1'-biphenyl]-4-carboxaldehyde

CAS: 39802-78-3

2'-Chloro-[1,1'-biphenyl]-4-carboxaldehyde

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.66g/mol

Ref: 54-OR7346

2′-Chloro-biphenyl-4-carbaldehyde

CAS: 39802-78-3

Formula: C₁₃H₉ClO

Purity: 99%(GC-MS);RG

Color and Shape: Solid, solid

Molecular weight: 216.66

Ref: 10-F032295