CAS 398138-28-8

Prostaglandin D2 ethanolamide

Description:

Prostaglandin D2 ethanolamide, also known as PGD2 ethanolamide, is a bioactive lipid compound that plays a significant role in various physiological processes. It is derived from prostaglandin D2, a member of the prostaglandin family, which are lipid compounds involved in inflammation, immune responses, and the regulation of various biological functions. The ethanolamide form indicates the presence of an ethanolamine group, which can influence its biological activity and interactions with receptors. Prostaglandin D2 ethanolamide is known to interact with specific receptors, such as the DP1 receptor, and may have implications in sleep regulation, allergic responses, and neuroinflammation. Its structure includes a cyclopentane ring and multiple functional groups that contribute to its reactivity and solubility in biological systems. As a research compound, it is often studied for its potential therapeutic applications, particularly in the context of inflammatory diseases and neurological disorders. However, detailed pharmacological profiles and specific biological effects are still subjects of ongoing research.

Formula: C₂₂H₃₇NO₅

InChI: InChI=1S/C22H37NO5/c1-2-3-6-9-17(25)12-13-19-18(20(26)16-21(19)27)10-7-4-5-8-11-22(28)23-14-15-24/h4,7,12-13,17-20,24-26H,2-3,5-6,8-11,14-16H2,1H3,(H,23,28)/b7-4-,13-12+/t17-,18+,19+,20-/m0/s1

InChI key: InChIKey=KEYDJKSQFDUAGF-YIRKRNQHSA-N

SMILES: C(=C/[C@H](CCCCC)O)\[C@@H]1[C@@H](C/C=C\CCCC(NCCO)=O)[C@@H](O)CC1=O

Synonyms:

• (5Z,9α,13E,15S)-9,15-Dihydroxy-N-(2-hydroxyethyl)-11-oxoprosta-5,13-dien-1-amide
• Prostamide D2
• Prosta-5,13-dien-1-amide, 9,15-dihydroxy-N-(2-hydroxyethyl)-11-oxo-, (5Z,9α,13E,15S)-
• Prostaglandin D2 ethanolamide

Prostaglandin D2 Ethanolamide

CAS: 398138-28-8

PGD2-EA, made from anandamide by COX-2 and PGD synthase, boosts inhibitory brain signals and causes colorectal cancer cell death.

Formula: C₂₂H₃₇NO₅

Color and Shape: Solid

Molecular weight: 395.53

Ref: TM-T38389