CAS 39815-40-2

Bisoxireno[5,6:9,10]cyclodeca[1,2-b]furan-3(1bH)-one, 5-(acetyloxy)decahydro-6a,9a-dimethyl-4-methylene-, (1aR,1bS,4aR,5R,6aR,7aR,9aR)-

Description:

Bisoxireno[5,6:9,10]cyclodeca[1,2-b]furan-3(1bH)-one, 5-(acetyloxy)decahydro-6a,9a-dimethyl-4-methylene-, with the CAS number 39815-40-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and oxirane functionalities. This compound features multiple stereocenters, contributing to its potential for stereoisomerism, which can influence its chemical reactivity and biological activity. The presence of an acetyloxy group suggests that it may participate in esterification reactions, while the decahydro framework indicates a saturated cyclic structure that could exhibit stability under various conditions. The dimethyl and methylene groups provide additional points of reactivity and steric hindrance, which may affect its interactions with other molecules. Overall, this compound's intricate structure and functional groups make it a subject of interest in fields such as organic synthesis and medicinal chemistry, where understanding its properties could lead to applications in drug development or material science.

Formula: C₁₇H₂₂O₆

InChI: InChI=1S/C17H22O6/c1-8-12-10(20-9(2)18)7-17(4)11(22-17)5-6-16(3)14(23-16)13(12)21-15(8)19/h10-14H,1,5-7H2,2-4H3

InChI key: InChIKey=WVJZWGBZQIZLSZ-UHFFFAOYSA-N

SMILES: CC12C(C3C(C(OC(C)=O)CC4(C)C(CC1)O4)C(=C)C(=O)O3)O2

Synonyms:

• Bisoxireno[5,6:9,10]cyclodeca[1,2-b]furan-3(1bH)-one, 5-(acetyloxy)decahydro-6a,9a-dimethyl-4-methylene-, (1aR,1bS,4aR,5R,6aR,7aR,9aR)-
• Bisoxireno[5,6:9,10]cyclodeca[1,2-b]furan-3(1bH)-one, 5-(acetyloxy)decahydro-6a,9a-dimethyl-4-methylene-, [1aR-(1aR*,1bS*,4aR*,5R*,6aR*,7aR*,9aR*)]-
• Epitulipinolide diepoxide

Epitulipinolide diepoxide

CAS: 39815-40-2

Formula: C₁₇H₂₂O₆

Purity: 98.5%

Molecular weight: 322.3530

Ref: IN-DA00CHU5

Epitulipinolide diepoxide

CAS: 39815-40-2

Epitulipinolide diepoxide inhibits melanoma growth, has anti-cancer properties, and kills KB cells.

Formula: C₁₇H₂₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 322.35

Ref: TM-TN5329

Epitulipinolide diepoxide

CAS: 39815-40-2

Formula: C₁₇H₂₂O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 322.357

Ref: BP-SBP00198

Epitulipinolide diepoxide

CAS: 39815-40-2

Epitulipinolide diepoxide is a naturally occurring compound, which is a sesquiterpene lactone isolated from the plant genus Vernonia, found predominantly in tropical regions. This compound plays a critical role as a secondary metabolite with antifungal and anti-inflammatory properties. The mode of action of Epitulipinolide diepoxide involves the disruption of microbial cell membranes and the inhibition of pro-inflammatory cytokine production. These mechanisms make it a valuable subject of study in natural product chemistry and pharmacology.

Formula: C₁₇H₂₂O₆

Purity: Min. 95%

Molecular weight: 322.4 g/mol

Ref: 3D-PBA81540