CymitQuimica logo

CAS 39828-47-2

:

2-oxo-2,3-dihydro-1H-imidazole-4-carboxylic acid

Description:
2-Oxo-2,3-dihydro-1H-imidazole-4-carboxylic acid, also known by its CAS number 39828-47-2, is a heterocyclic organic compound featuring an imidazole ring. This compound is characterized by the presence of a carboxylic acid functional group and a keto group, contributing to its reactivity and potential biological activity. It typically appears as a white to off-white solid and is soluble in polar solvents, which is common for compounds containing carboxylic acids. The imidazole ring structure imparts unique properties, making it of interest in various fields, including medicinal chemistry and biochemistry. The compound may exhibit various biological activities, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 2-oxo-2,3-dihydro-1H-imidazole-4-carboxylic acid represents a valuable compound in chemical research and development.
Formula:C4H4N2O3
InChI:InChI=1/C4H4N2O3/c7-3(8)2-1-5-4(9)6-2/h1H,(H,7,8)(H2,5,6,9)
InChI key:XJSWLMGZMRUNLP-UHFFFAOYSA-N
SMILES:c1c(C(=O)O)[nH]c(n1)O
Synonyms:
  • 1H-imidazole-4-carboxylic acid, 2,3-dihydro-2-oxo-
  • 2-oxo-2,3-dihydro-1H-imidazole-4-carboxylate
Found 4 products.