CAS 39835-11-5

2-hydroxy-5-methoxybenzonitrile

Description:

2-Hydroxy-5-methoxybenzonitrile, with the CAS number 39835-11-5, is an organic compound characterized by the presence of both hydroxyl (-OH) and methoxy (-OCH3) functional groups attached to a benzene ring that also features a nitrile (-CN) group. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its aromatic nature. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the methoxy group can influence its electronic properties and reactivity. The nitrile group introduces a polar character, which can enhance solubility in polar solvents. 2-Hydroxy-5-methoxybenzonitrile may be utilized in various chemical syntheses and research applications, particularly in the fields of pharmaceuticals and agrochemicals, due to its potential biological activity. Its structural features suggest that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile compound in organic synthesis.

Formula: C₈H₇NO₂

InChI: InChI=1/C8H7NO2/c1-11-7-3-2-6(5-9)8(10)4-7/h2-4,10H,1H3

SMILES: COc1ccc(C#N)c(c1)O

Synonyms:

• Benzonitrile, 2-hydroxy-5-methoxy-
• 2-Hydroxy-4-Methoxybenzonitrile

Benzonitrile, 2-​hydroxy-​4-​methoxy-

CAS: 39835-11-5

Formula: C₈H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.1467

Ref: IN-DA00C0GY

2-Hydroxy-4-methoxybenzonitrile

CAS: 39835-11-5

2-Hydroxy-4-methoxybenzonitrile

Purity: 97%

Molecular weight: 149.15g/mol

Ref: 54-OR907186

2-Hydroxy-4-methoxybenzonitrile

CAS: 39835-11-5

Formula: C₈H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 149.149

Ref: 10-F076788