CAS 39835-14-8

2-hydroxy-4-nitrobenzonitrile

Description:

2-Hydroxy-4-nitrobenzonitrile, with the CAS number 39835-14-8, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a nitro group (-NO2) on a benzene ring that is also substituted with a nitrile group (-C≡N). This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its reactivity, making it useful in various chemical syntheses, particularly in the field of pharmaceuticals and agrochemicals. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility and reactivity, while the nitro group can influence the compound's electronic properties and reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the nitrile group can provide sites for further chemical modifications. Safety data should be consulted, as compounds with nitro and hydroxyl functionalities can exhibit varying degrees of toxicity and environmental impact.

Formula: C₇H₄N₂O₃

InChI: InChI=1/C7H4N2O3/c8-4-5-1-2-6(9(11)12)3-7(5)10/h1-3,10H

SMILES: c1cc(cc(c1C#N)O)N(=O)=O

Synonyms:

• Benzonitrile, 2-hydroxy-4-nitro-

2-Hydroxy-4-nitrobenzonitrile

CAS: 39835-14-8

Formula: C₇H₄N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1183

Ref: IN-DA0076WM

2-Hydroxy-4-Nitrobenzonitrile

CAS: 39835-14-8

2-Hydroxy-4-Nitrobenzonitrile

Purity: 98%

Molecular weight: 164.12g/mol

Ref: 54-OR1026801

2-Hydroxy-4-nitrobenzonitrile

CAS: 39835-14-8

2-Hydroxy-4-nitrobenzonitrile is a nitrile derivative that has an antibacterial activity. This compound interacts with the pyochelin, a siderophore in Pseudomonas aeruginosa. The antibiotic inhibits the uptake of pyochelin by the bacteria and causes cell death by inhibiting the synthesis of proteins necessary for bacterial growth. 2-Hydroxy-4-nitrobenzonitrile can be used as a potential stabilizer for materials such as polystyrene and polyurethane which are susceptible to degradation by hydrolysis or oxidation. In addition, this compound is also useful in gram-negative bacterium due to its ability to inhibit their growth by binding to their ribosomes. The conformational studies have been shown to be important for understanding the biological properties of this molecule.

Formula: C₇H₄N₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 164.12 g/mol

Ref: 3D-FH70360

2-Hydroxy-4-nitrobenzonitrile

CAS: 39835-14-8

Formula: C₇H₄N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.12

Ref: 10-F012255