CAS 398487-76-8

4-Fluoro-2-methyl-1H-indol-5-amine

Description:

4-Fluoro-2-methyl-1H-indol-5-amine is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and a methyl group at the 2-position of the indole ring contributes to its unique chemical properties. This compound typically exhibits basicity due to the amino group (-NH2) at the 5-position, which can participate in hydrogen bonding and influence its reactivity. It is often used in medicinal chemistry and research due to its potential biological activity, including interactions with various receptors or enzymes. The compound's solubility and stability can vary depending on the solvent and environmental conditions. Additionally, its molecular structure allows for various synthetic modifications, making it a valuable intermediate in the development of pharmaceuticals. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₉FN₂

InChI: InChI=1/C9H9FN2/c1-5-4-6-8(12-5)3-2-7(11)9(6)10/h2-4,12H,11H2,1H3

SMILES: Cc1cc2c(ccc(c2F)N)[nH]1

Synonyms:

• 1H-indol-5-amine, 4-fluoro-2-methyl-
• 5-Amino-4-fluoro-2-methylindole

1H-Indol-5-amine,4-fluoro-2-methyl-(9CI)

CAS: 398487-76-8

Formula: C₉H₉FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.1796

Ref: IN-DA00CAPH

4-Fluoro-2-methyl-1H-indol-5-amine

CAS: 398487-76-8

4-Fluoro-2-methyl-1H-indol-5-amine

Purity: 98%

Molecular weight: 164.18g/mol

Ref: 54-PC201247

4-Fluoro-2-methyl-1H-indol-5-amine

CAS: 398487-76-8

Formula: C₉H₉FN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.183

Ref: 10-F236538