CAS 39878-87-0
:Benzeneacetyl chloride, α-amino-, hydrochloride (1:1), (αR)-
Description:
Benzeneacetyl chloride, α-amino-, hydrochloride (1:1), (αR)-, with the CAS number 39878-87-0, is a chemical compound that features both an aromatic ring and an acyl chloride functional group. This compound is characterized by its ability to participate in acylation reactions due to the presence of the benzeneacetyl chloride moiety, which can react with nucleophiles, including amines. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in certain conditions. The (αR)- designation refers to the specific stereochemistry of the amino group, which can influence the compound's biological activity and interactions. Typically, such compounds are utilized in organic synthesis and pharmaceutical applications, particularly in the development of drugs or intermediates. Safety considerations include handling precautions due to the reactivity of the acyl chloride group, which can be corrosive and may release hydrochloric acid upon hydrolysis.
Formula:C8H8ClNO·ClH
InChI:InChI=1S/C8H8ClNO.ClH/c9-8(11)7(10)6-4-2-1-3-5-6;/h1-5,7H,10H2;1H/t7-;/m1./s1
InChI key:InChIKey=GVVFCAFBYHYGEE-OGFXRTJISA-N
SMILES:[C@@H](C(Cl)=O)(N)C1=CC=CC=C1.Cl
Synonyms:- (-)-Alpha-(Chloroformyl)Benzylammonium Chloride
- (-)-Phenylglycyl chloride hydrochloride
- (2R)-amino(phenyl)ethanoyl chloride hydrochloride (1:1)
- (R)-(-)-2-Phenylglycine chloride hydrochloride
- (R)-2-Amino-2-phenylacetyl chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-2-Amino-2-phenylacetyl chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-2-Phenylglycyl chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-Phenylglycine chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-Phenylglycyl chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-α-Aminophenylacetic acid chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-α-Aminophenylacetyl chloride hydrochloride
- <span class="text-smallcaps">D</span>-(-)-α-Phenylglycyl chloride hydrochloride
- Amino(Phenyl)Acetyl Chloride Hydrochloride (1:1)
- Benzeneacetyl chloride, α-amino-, hydrochloride (1:1), (αR)-
- Benzeneacetyl chloride, α-amino-, hydrochloride, (R)-
- Benzeneacetyl chloride, α-amino-, hydrochloride, (αR)-
- D(-)-Phenyl Glycine HCl
- D-alpha-Phenylglycine chloride hydrochloride
- D-(-)-α-Phenylglycyl chloride hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-2-Amino-2-phenylacetyl chloride hydrochloride
CAS:(R)-2-Amino-2-phenylacetyl chloride hydrochlorideFormula:C8H9Cl2NOPurity:95%Molecular weight:206.07(R)-2-Amino-2-phenylacetyl chloride hydrochloride
CAS:Formula:C8H9Cl2NOPurity:95%Color and Shape:SolidMolecular weight:206.0692(R)-(-)-2-Phenylglycine Chloride HCl
CAS:Formula:C8H8ClNO·HClColor and Shape:White To Off-White SolidMolecular weight:169.61 36.46(R)-2-Amino-2-phenylacetyl chloride hydrochloride
CAS:(R)-2-Amino-2-phenylacetyl chloride hydrochlorideFormula:C8H9Cl2NOPurity:95%Molecular weight:206.07(R)-(-)-2-Phenylglycine chloride hydrochloride
CAS:Formula:C8H9Cl2NOPurity:95%Color and Shape:SolidMolecular weight:206.07




