CAS 39880-77-8
:N-methylthiophene-2-carboxamide
Description:
N-methylthiophene-2-carboxamide is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a carboxamide functional group (-C(=O)NH2) indicates that it has both carbonyl and amine characteristics, contributing to its potential as a polar molecule. The methyl group attached to the nitrogen atom enhances its solubility in organic solvents. This compound is typically used in various chemical syntheses and may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the thiophene ring and the carboxamide group. Overall, N-methylthiophene-2-carboxamide is a versatile compound with applications in organic synthesis and medicinal chemistry, reflecting the importance of heterocyclic compounds in these fields.
Formula:C6H7NOS
InChI:InChI=1/C6H7NOS/c1-7-6(8)5-3-2-4-9-5/h2-4H,1H3,(H,7,8)
SMILES:CNC(=O)c1cccs1
Synonyms:- 2-thiophenecarboxamide, N-methyl-
- N-Methyl-2-thiophencarboxamid
- N-Methyl-2-thiophenecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-Methylthiophene-2-carboxamide
CAS:N-Methylthiophene-2-carboxamidePurity:95%Molecular weight:141.19g/molN-Methylthiophene-2-carboxamide
CAS:Controlled ProductFormula:C6H7NOSColor and Shape:NeatMolecular weight:141.19N-Methylthiophene-2-carboxamide
CAS:Controlled ProductFormula:C6H7NOSColor and Shape:NeatMolecular weight:141.19N-Methylthiophene-2-carboxamide
CAS:N-Methylthiophene-2-carboxamide is an organic compound with a carbonyl group. The conformational and molecular parameters of this compound have been determined using X-ray diffraction and validated by quantum chemical calculations. It has been shown that N-Methylthiophene-2-carboxamide can modulate the conformational behavior of proteins, including their function as enzyme inhibitors, and it is also able to bind to DNA in a covalent manner. N-Methylthiophene-2-carboxamide can be used as a solvent for other molecules that are insoluble in water or other solvents.Formula:C6H7NOSPurity:Min. 95%Molecular weight:141.19 g/mol





