CAS 39889-77-5

1-(4-methylphenyl)-1H-tetrazol-5-amine

Description:

1-(4-Methylphenyl)-1H-tetrazol-5-amine, with the CAS number 39889-77-5, is an organic compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. This compound features a 4-methylphenyl group, indicating the presence of a methyl substituent on a phenyl ring, which contributes to its hydrophobic characteristics. The amine functional group at the 5-position of the tetrazole ring enhances its potential for hydrogen bonding and reactivity. This compound is typically used in various chemical syntheses and may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, and it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₉N₅

InChI: InChI=1/C8H9N5/c1-6-2-4-7(5-3-6)13-8(9)10-11-12-13/h2-5H,1H3,(H2,9,10,12)

SMILES: Cc1ccc(cc1)n1c(=N)nn[nH]1

1-(4-Methylphenyl)-1H-1,2,3,4-tetrazol-5-amine

CAS: 39889-77-5

Versatile small molecule scaffold

Formula: C₈H₉N₅

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-PBA88977