CAS 3989-50-2

N-[4-(hydrazinylsulfonyl)phenyl]acetamide

Description:

N-[4-(hydrazinylsulfonyl)phenyl]acetamide, with the CAS number 3989-50-2, is a chemical compound characterized by its hydrazine and sulfonamide functional groups. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the sulfonamide moiety, which enhances its hydrophilicity. The hydrazine group contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with hydrazine derivatives are often explored for their biological activities. Additionally, the presence of the acetamide group may influence its pharmacokinetic properties, such as solubility and stability. Overall, N-[4-(hydrazinylsulfonyl)phenyl]acetamide is of interest in both synthetic and medicinal chemistry due to its unique functional groups and potential biological applications.

Formula: C₈H₁₁N₃O₃S

InChI: InChI=1/C8H11N3O3S/c1-6(12)10-7-2-4-8(5-3-7)15(13,14)11-9/h2-5,11H,9H2,1H3,(H,10,12)

SMILES: CC(=Nc1ccc(cc1)S(=O)(=O)NN)O

Synonyms:

• Benzenesulfonic Acid, 4-(Acetylamino)-, Hydrazide
• N-[4-(Hydrazinosulfonyl)phenyl]acetamide
• N-(4-(Hydrazinylsulfonyl)phenyl)acetamide
• 4-(Acetylamino)benzenesulfonohydrazide
• 4-(Acetylamino)benzenesulfonic acid hydrazide
• 4-acetamidobenzenesulfonylhydrazine

N-[4-(Hydrazinosulfonyl)phenyl]acetamide

CAS: 3989-50-2

Formula: C₈H₁₁N₃O₃S

Molecular weight: 229.2562

Ref: IN-DA00CNXR

N-[4-(hydrazinosulfonyl)phenyl]acetamide

CAS: 3989-50-2

Formula: C₈H₁₁N₃O₃S

Molecular weight: 229.25

Ref: 10-F365402