CAS 39891-13-9
:6-Chloro-3-pyridineacetic acid
Description:
6-Chloro-3-pyridineacetic acid is an organic compound characterized by its pyridine ring and a carboxylic acid functional group. It features a chlorine atom at the 6-position of the pyridine ring and an acetic acid moiety at the 3-position. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, due to the presence of the carboxylic acid group. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where it may act as an intermediate or active ingredient. The presence of the chlorine atom can influence its reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and stability, can vary based on environmental conditions and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c8-6-2-1-5(4-9-6)3-7(10)11/h1-2,4H,3H2,(H,10,11)
SMILES:c1cc(Cl)ncc1CC(=O)O
Synonyms:- (6-Chloropyridin-3-yl)acetic acid
- 3-Pyridineacetic acid, 6-chloro-
- 2-Chloropyridine-5-acetic acid
- (6-Chloro-pyridin-3-yl)-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Chloro-3-pyridineacetic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6ClNO2Purity:97%Color and Shape:Powder, Pale cream to cream to brownMolecular weight:171.582-(2-Chloropyridin-5-yl)acetic acid
CAS:Formula:C7H6ClNO2Purity:98%Color and Shape:SolidMolecular weight:171.5810(6-Chloropyridin-3-yl)acetic acid
CAS:(6-Chloropyridin-3-yl)acetic acidFormula:C7H6ClNO2Purity:98%Color and Shape: yellow brown solidMolecular weight:171.58g/mol(6-Chloro-pyridin-3-yl)-acetic acid
CAS:Formula:C7H6ClNO2Purity:97%Color and Shape:SolidMolecular weight:171.58



