CAS 39893-64-6
:α,2-Dimethyl-4-nitro-1H-imidazole-1-ethanol
Description:
α,2-Dimethyl-4-nitro-1H-imidazole-1-ethanol, with the CAS number 39893-64-6, is a chemical compound that features a five-membered imidazole ring substituted with both methyl and nitro groups, as well as a hydroxyl (ethanol) functional group. This compound is characterized by its potential applications in various fields, including pharmaceuticals and agrochemicals, due to the presence of the nitro group, which can enhance biological activity. The imidazole ring contributes to its ability to participate in coordination chemistry and biological interactions, making it a subject of interest in medicinal chemistry. The presence of the hydroxyl group suggests that it may exhibit solubility in polar solvents, which can influence its reactivity and interaction with other chemical species. Additionally, the methyl substitutions can affect the compound's steric properties and overall stability. Overall, α,2-Dimethyl-4-nitro-1H-imidazole-1-ethanol is a versatile compound with unique structural features that may lead to diverse chemical behaviors and applications.
Formula:C7H11N3O3
InChI:InChI=1S/C7H11N3O3/c1-5(11)3-9-4-7(10(12)13)8-6(9)2/h4-5,11H,3H2,1-2H3
InChI key:InChIKey=JRXLILGOSVVPCW-UHFFFAOYSA-N
SMILES:C(C(C)O)N1C=C(N(=O)=O)N=C1C
Synonyms:- 1H-Imidazole-1-ethanol, α,2-dimethyl-4-nitro-
- α,2-Dimethyl-4-nitro-1H-imidazole-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
