CAS 399-24-6
:10-fluoro-1-phenyldecan-1-one
Description:
10-Fluoro-1-phenyldecan-1-one, with the CAS number 399-24-6, is an organic compound characterized by its ketone functional group and a fluorine atom attached to a decane chain. This compound features a phenyl group, which contributes to its aromatic properties, and the presence of the fluorine atom can influence its reactivity and physical properties, such as polarity and boiling point. Typically, compounds like this may exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the decane chain. The fluorine substitution can enhance the compound's stability and alter its interaction with biological systems, making it of interest in medicinal chemistry and material science. Additionally, the structure suggests potential applications in synthesis and as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as fluorinated compounds can have specific hazards associated with their use.
Formula:C16H23FO
InChI:InChI=1/C16H23FO/c17-14-10-5-3-1-2-4-9-13-16(18)15-11-7-6-8-12-15/h6-8,11-12H,1-5,9-10,13-14H2
SMILES:C(CCCCC(=O)c1ccccc1)CCCCF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decanophenone, 10-fluoro-
CAS:<p>Decanophenone, 10-fluoro- is a biochemical.</p>Formula:C16H23FOColor and Shape:SolidMolecular weight:250.35
