CAS 399-30-4
:(2-FLUOROBENZYL)METHYLAMINE
Description:
(2-Fluorobenzyl)methylamine is an organic compound characterized by the presence of a fluorobenzyl group attached to a methylamine moiety. Its molecular structure features a benzene ring substituted with a fluorine atom at the second position, which influences its reactivity and physical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the aromatic and amine functional groups that can participate in various chemical reactions. The fluorine atom can enhance the lipophilicity and metabolic stability of the compound, making it an interesting candidate for drug design. Additionally, (2-fluorobenzyl)methylamine may exhibit basic properties due to the amine group, allowing it to form salts with acids. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H10FN
InChI:InChI=1/C8H10FN/c1-10-6-7-4-2-3-5-8(7)9/h2-5,10H,6H2,1H3
SMILES:CNCc1ccccc1F
Synonyms:- (2-fluorophenyl)-N-methylmethanaminium
- 1-(2-fluorophenyl)-N-methylmethanamine
- N-Methyl-2-fluorobenzylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-N-methylbenzylamine, 95%
CAS:It is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed asFormula:C8H10FNPurity:95%Molecular weight:139.17(2-Fluorobenzyl)methylamine
CAS:Formula:C8H10FNPurity:95%Color and Shape:LiquidMolecular weight:139.1701(2-Fluorobenzyl)methylamine
CAS:Formula:C8H10FNPurity:95%Color and Shape:LiquidMolecular weight:139.173



