CAS 399-67-7

7-Fluoro-1H-indole-2-carboxylic acid

Description:

7-Fluoro-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 7-position and a carboxylic acid group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, capable of donating a proton from the carboxylic group. The fluorine substitution can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 7-Fluoro-1H-indole-2-carboxylic acid may participate in various chemical reactions, including esterification and amidation, allowing for the synthesis of derivatives with potential therapeutic applications. Its CAS number, 399-67-7, is a unique identifier that facilitates its recognition in chemical databases and literature.

Formula: C₉H₆FNO₂

InChI: InChI=1/C9H6FNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13)

InChI key: InChIKey=SCWBSQNVKBIKRY-UHFFFAOYSA-N

SMILES: FC1=C2C(C=C(C(O)=O)N2)=CC=C1

Synonyms:

• 1H-indole-2-carboxylic acid, 7-fluoro-
• 7-Fluoro-1H-indole-2-carboxylicacid
• Indole-2-carboxylic acid, 7-fluoro-
• 7-Fluoroindole-2-Carboxylic acid
• 7-Fluoro-1H-indole-2-carboxylic acid
• 7-Fluoro-indole-2-carboxylic acid

7-Fluoro-1H-indole-2-carboxylic acid

CAS: 399-67-7

Formula: C₉H₆FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.1478

Ref: IN-DA00BYME

7-Fluoro-1H-indole-2-carboxylic acid

CAS: 399-67-7

7-Fluoro-1H-indole-2-carboxylic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.15g/mol

Ref: 54-PC901298

7-Fluoro-1H-indole-2-carboxylic acid

CAS: 399-67-7

Formula: C₉H₆FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.15

Ref: 10-F058982