CAS 399-72-4
:5-Fluoro-2-methylindole
Description:
5-Fluoro-2-methylindole is an organic compound belonging to the indole family, characterized by a bicyclic structure that consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 5-position and a methyl group at the 2-position distinguishes it from other indole derivatives. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties, which contribute to its stability and reactivity. It is often utilized in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anticancer properties. The compound is soluble in organic solvents, and its reactivity can be influenced by the presence of the fluorine atom, which can participate in various chemical reactions. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 5-Fluoro-2-methylindole serves as an important building block in the synthesis of more complex molecules in pharmaceutical development.
Formula:C9H8FN
InChI:InChI=1S/C9H8FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3
InChI key:InChIKey=JJIUISYYTFDATN-UHFFFAOYSA-N
SMILES:CC=1NC=2C(C1)=CC(F)=CC2
Synonyms:- 1H-Indole, 5-fluoro-2-methyl-
- 5-Fluoro-2-Methyl-1,3-Benzothiazole
- 5-Fluoro-2-methyl-1H-indole
- Indole, 5-fluoro-2-methyl-
- 5-Fluoro-2-methylindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Fluoro-2-methylindole
CAS:Formula:C9H8FNPurity:>98.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:149.171H-Indole, 5-fluoro-2-methyl-
CAS:Formula:C9H8FNPurity:98%Color and Shape:SolidMolecular weight:149.16495-Fluoro-2-methyl-1H-indole
CAS:5-Fluoro-2-methyl-1H-indoleFormula:C9H8FNPurity:97%Color and Shape: solidMolecular weight:149.16g/mol5-Fluoro-2-methylindole
CAS:5-Fluoro-2-methylindole is a chemical intermediate that can be used in the synthesis of other compounds. It is a versatile building block with many applications, such as being a useful intermediate for the synthesis of heterocyclic compounds. This compound has been shown to have high quality and is a reagent that is useful in research laboratories. 5-Fluoro-2-methylindole reacts with aniline to form 2,6-diaminopyridine, which has been shown to have anti-inflammatory properties.
Formula:C9H8FNMolecular weight:149.17 g/mol





