CAS 399-82-6

S-1,3-benzothiazol-2-yl-L-cysteine

Description:

S-1,3-benzothiazol-2-yl-L-cysteine, with the CAS number 399-82-6, is a chemical compound that features a benzothiazole moiety linked to the amino acid L-cysteine. This compound is characterized by its unique structure, which includes a sulfur-containing thiazole ring and a thiol group from the cysteine residue, contributing to its potential reactivity and biological activity. It is often studied for its role in biochemical processes, particularly in relation to antioxidant properties and metal chelation. The presence of the benzothiazole group may enhance its ability to interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit solubility in polar solvents, which is typical for amino acid derivatives. Its properties can be influenced by factors such as pH and the presence of other ions or molecules in solution. Overall, S-1,3-benzothiazol-2-yl-L-cysteine is a compound of interest in both research and potential therapeutic applications.

Formula: C₁₀H₁₀N₂O₂S₂

InChI: InChI=1/C10H10N2O2S2/c11-6(9(13)14)5-15-10-12-7-3-1-2-4-8(7)16-10/h1-4,6H,5,11H2,(H,13,14)/t6-/m0/s1

SMILES: c1ccc2c(c1)nc(SC[C@@H](C(=O)O)N)s2

s-(Benzo[d]thiazol-2-yl)-l-cysteine

CAS: 399-82-6

s-(Benzo[d]thiazol-2-yl)-l-cysteine

Purity: 98%

Molecular weight: 254.34g/mol

Ref: 54-OR1035707

s-(Benzo[d]thiazol-2-yl)-l-cysteine

CAS: 399-82-6

Purity: 98%

Molecular weight: 254.32

Ref: 10-F988665

S-2-Benzothiazolyl-L-cysteine

Controlled Product

CAS: 399-82-6

Stability Hygroscopic, Unstable in solution
Applications S-2-Benzothiazolyl-L-cysteine (BTC) is a poor substrate for purified glutamine transaminase K from mitochondria and cytosol.
References Lash, L., et al.: J. Biol. Chem., 261, 13076 (1986), Green, T., et al.: Toxicol. Appl. Phamacol., 103, 77 (1990), Bruning, T., et al.: Arch. Toxicol., 71, 332 (1997),

Formula: C₁₀H₁₀N₂O₂S₂

Color and Shape: Neat

Molecular weight: 254.33

Ref: TR-B206785