CAS 39900-63-5

2-Hydroxy-5-methoxybenzonitrile

Description:

2-Hydroxy-5-methoxybenzonitrile, with the CAS number 39900-63-5, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzene ring, along with a nitrile group (-C≡N). This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the methoxy group can influence its electronic properties and reactivity. The nitrile group introduces a polar functional group, which can enhance the compound's reactivity in nucleophilic addition reactions. 2-Hydroxy-5-methoxybenzonitrile may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the functionalization of a suitable precursor compound, and its properties can be further explored through spectroscopic methods such as NMR and IR spectroscopy. Overall, this compound exemplifies the diverse chemistry of substituted benzenes and their derivatives.

Formula: C₈H₇NO₂

InChI: InChI=1S/C8H7NO2/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4,10H,1H3

InChI key: InChIKey=ZFKRGDMEHBTPFN-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(OC)=CC=C1O

Synonyms:

• 2-Hydroxy-4-Methoxybenzonitrile
• Benzonitrile, 2-hydroxy-5-methoxy-
• 2-Hydroxy-5-methoxybenzonitrile

2-Hydroxy-5-methoxybenzonitrile

CAS: 39900-63-5

Formula: C₈H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.1467

Ref: IN-DA0076KC

2-Hydroxy-5-methoxybenzonitrile

CAS: 39900-63-5

2-Hydroxy-5-methoxybenzonitrile

Purity: 98%

Molecular weight: 149.15g/mol

Ref: 54-OR947332

2-Hydroxy-5-methoxy-benzonitrile

CAS: 39900-63-5

Formula: C₈H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.149

Ref: 10-F025345

2-Hydroxy-5-methoxy-benzonitrile

CAS: 39900-63-5

2-Hydroxy-5-methoxy-benzonitrile (2HMOB) is a benzene carbonitrile that can be used in the synthesis of many different types of organic compounds. 2HMOB is synthesized by reacting anisole with benzyl bromide in the presence of a copper(I) catalyst. The reaction occurs through the following series of steps:

Formula: C₈H₇NO₂

Purity: Min. 95%

Molecular weight: 149.15 g/mol

Ref: 3D-PBA90063