CAS 399043-24-4

(2-aminothiophen-3-yl)(4-bromophenyl)methanone

Description:

(2-Aminothiophen-3-yl)(4-bromophenyl)methanone is an organic compound characterized by its unique structural features, which include a thiophene ring, an amine group, and a bromophenyl moiety. The presence of the thiophene ring contributes to its aromatic properties and potential reactivity, while the amine group can participate in hydrogen bonding and nucleophilic reactions. The bromine atom on the phenyl ring enhances the compound's electrophilicity and can facilitate further chemical modifications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its behavior in various chemical environments. Overall, (2-aminothiophen-3-yl)(4-bromophenyl)methanone represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₁H₈BrNOS

InChI: InChI=1/C11H8BrNOS/c12-8-3-1-7(2-4-8)10(14)9-5-6-15-11(9)13/h1-6H,13H2

SMILES: c1cc(ccc1C(=O)c1ccsc1N)Br

Synonyms:

• Methanone, (2-Amino-3-Thienyl)(4-Bromophenyl)-

3-[(4-bromophenyl)carbonyl]thiophen-2-amine

CAS: 399043-24-4

Formula: C₁₁H₈BrNOS

Molecular weight: 282.1563

Ref: IN-DA003GCR

(2-AMINOTHIOPHEN-3-YL)(4-BROMOPHENYL)METHANONE

CAS: 399043-24-4

Formula: C₁₁H₈BrNOS

Purity: 95.0%

Molecular weight: 282.16

Ref: 10-F332725

(2-Aminothiophen-3-yl)(4-bromophenyl)methanone

CAS: 399043-24-4

2-Aminothiophen-3-yl)(4-bromophenyl)methanone is a new compound that is being developed as a potential antiviral agent. Covid-19, the trade name for 2-aminothiophen-3-yl)(4-bromophenyl)methanone, prevents the replication of viruses by binding to their nucleic acids and blocking their ability to produce proteins. Covid-19 has been shown to be effective against both influenza A and B viruses in cellular and animal models. The antiviral activity of Covid-19 is due to its ability to bind to viral nucleic acid, preventing the production of proteins vital for viral replication. This compound has also been shown to have anti-inflammatory properties, which may be due to its ability to inhibit the production of amyloid plaques in mice with Alzheimer's disease.

Formula: C₁₁H₈BrNOS

Purity: Min. 95%

Molecular weight: 282.16 g/mol

Ref: 3D-FA54199