CAS 39917-38-9
:1-(3-hydroxytricyclo[3.3.1.1~3,7~]dec-1-yl)ethanone
Description:
1-(3-Hydroxytricyclo[3.3.1.1^3,7]dec-1-yl)ethanone, with the CAS number 39917-38-9, is a chemical compound characterized by its complex tricyclic structure. This substance features a hydroxyl group (-OH) attached to a tricyclic decalin framework, which contributes to its unique physical and chemical properties. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits reactivity associated with carbonyl compounds, such as nucleophilic addition. The tricyclic nature of the compound suggests potential rigidity in its molecular conformation, which can influence its interactions and solubility in various solvents. Additionally, the hydroxyl group may impart some degree of polarity, affecting its solubility in polar solvents. This compound may have applications in organic synthesis or medicinal chemistry, although specific biological activities or uses would require further investigation. Overall, its structural complexity and functional groups make it an interesting subject for study in the fields of organic and medicinal chemistry.
Formula:C12H18O2
InChI:InChI=1/C12H18O2/c1-8(13)11-3-9-2-10(4-11)6-12(14,5-9)7-11/h9-10,14H,2-7H2,1H3
SMILES:CC(=O)C12CC3CC(C1)CC(C3)(C2)O
Synonyms:- 1-(3-Hydroxy-adamantan-1-yl)-ethanone
- 1-Acetyl-3-Hydroxyadamantane
- Ethanone, 1-(3-hydroxytricyclo[3.3.1.1(3,7)]dec-1-yl)-
- 1-[(5R,7S)-3-hydroxytricyclo[3.3.1.1~3,7~]dec-1-yl]ethanone
- 3-Hydroxy-1-Acetyl Adamantane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(3-Hydroxy-1-adamantyl)ethanone
CAS:Controlled ProductFormula:C12H18O2Color and Shape:NeatMolecular weight:194.271-(3-Hydroxyadamantan-1-yl)ethan-1-one
CAS:1-(3-Hydroxyadamantan-1-yl)ethan-1-one (HAEE) is a racemic mixture of 1-(3-hydroxyadamantan-1-yl)ethanol (HAEE). HAEE can be synthesized from ethyl formate and quinidine. The process optimization step includes the reaction time and alkalization. HAEE has been used in the synthesis of quinine, an antimalarial drug, and to produce enolate salts. This process is optimized with chloride as a chlorinating agent and ethyl formate as an alkylating agent.Formula:C12H18O2Purity:Min. 95%Molecular weight:194.27 g/mol




