CymitQuimica logo

CAS 39919-58-9

:

5-bromo-2-tert-butylpyridine

Description:
5-Bromo-2-tert-butylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a tert-butyl group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water due to the hydrophobic tert-butyl group. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions, making it a useful intermediate in organic synthesis. Additionally, the tert-butyl group enhances the steric hindrance around the nitrogen atom, influencing the compound's reactivity and interactions with other molecules. Overall, 5-bromo-2-tert-butylpyridine is valuable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, owing to its distinctive structural features and reactivity.
Formula:C9H12BrN
InChI:InChI=1/C9H12BrN/c1-9(2,3)8-5-4-7(10)6-11-8/h4-6H,1-3H3
InChI key:HAJSOFXLKFWERP-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cn1)Br
Found 4 products.