CAS 39924-52-2
:Methyl 3-oxo-2-(2-penten-1-yl)cyclopentaneacetate
Description:
Methyl 3-oxo-2-(2-penten-1-yl)cyclopentaneacetate, identified by its CAS number 39924-52-2, is an organic compound characterized by its unique structure that includes a cyclopentane ring and various functional groups. This compound features a ketone group (3-oxo) and an ester group (methyl acetate), which contribute to its reactivity and potential applications in organic synthesis. The presence of a pentenyl substituent indicates that it has unsaturation, which can be involved in various chemical reactions, such as addition or polymerization. Methyl 3-oxo-2-(2-penten-1-yl)cyclopentaneacetate may exhibit properties typical of esters, such as pleasant odors and solubility in organic solvents, making it useful in flavor and fragrance industries. Additionally, its structural complexity suggests potential utility in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. However, specific physical properties like boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C13H20O3
InChI:InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3
InChI key:InChIKey=GEWDNTWNSAZUDX-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1C(CC=CCC)C(=O)CC1
Synonyms:- (3-Oxo-2-(2-pentenyl)-1-cyclopentyl)acetic acid methyl ester
- Cyclopentaneacetic acid, 3-oxo-2-(2-penten-1-yl)-, methyl ester
- Cyclopentaneacetic acid, 3-oxo-2-(2-pentenyl)-, methyl ester
- FEMA No. 3410
- Methyl 2-pentenyl-3-oxocyclopentaneacetate
- Methyl 3-oxo-2-(2-penten-1-yl)cyclopentaneacetate
- Methyl epi-jasmonate
- [3-Oxo-2-(Pent-2-En-1-Yl)Cyclopentyl]Acetic Acid
- methyl {3-oxo-2-[(2E)-pent-2-en-1-yl]cyclopentyl}acetate
- methyl {3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetate
- Methyl 2-(3-oxo-2-pent-2-enylcyclopentyl)acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Jasmonic Acid methyl ester
CAS:Formula:C13H20O3Purity:95%Color and Shape:LiquidMolecular weight:224.2961(±)-Methyl Jasmonate
CAS:Methyl 2-(3-oxo-2-(pent-2-en-1-yl)cyclopentyl)acetate ((±)-Jasmonic Acid methyl ester)induces the synthesis of proteinase inhibitors in plant leaves.Formula:C13H20O3Purity:98.95% - 99.39%Color and Shape:Colorless Liquid Clear To Pale Yellow LiquidMolecular weight:224.3Methyl jasmonate
CAS:<p>Methyl jasmonate is a bioactive compound that is found in plants. It is a potent inducer of protein synthesis and transcription of genes involved in the plant's defense response. Methyl jasmonate has been shown to be an optimum concentration (0.1 μM) synchronous fluorescence induction, which occurs in vitro in HL-60 cells. This compound is not cytotoxic but induces cell death through apoptosis by increasing the expression of proteins involved in DNA replication, repair, and transcription. The bioactive phenolic compounds that are induced by methyl jasmonate are also responsible for its antioxidant properties. Methyl jasmonate may also play a role in the brain, as it has been shown to regulate neurotransmitter release and gene expression of synapses in rat brains. This compound also plays a role in leaf senescence by inducing the production of chlorogenic acids and polyphenols.</p>Formula:C13H20O3Purity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:224.3 g/mol




