CymitQuimica logo

CAS 39925-11-6

:

Methyl 1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-5-carboxylate

Description:
Methyl 1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-5-carboxylate is a chemical compound characterized by its complex structure, which includes a triazole ring and a ribofuranosyl moiety. The presence of the tri-O-acetyl groups indicates that the ribofuranose is fully acetylated, enhancing its stability and solubility in organic solvents. This compound is typically used in biochemical research, particularly in the synthesis of nucleoside analogs and as a potential antiviral agent. Its triazole ring contributes to its biological activity, as triazoles are known to interact with various biological targets. The methyl ester functional group at the carboxylate position may influence its reactivity and solubility. Overall, this compound exemplifies the intersection of carbohydrate chemistry and heterocyclic chemistry, making it a valuable molecule in medicinal chemistry and drug development.
Formula:C15H19N3O9
InChI:InChI=1S/C15H19N3O9/c1-7(19)24-5-10-11(25-8(2)20)12(26-9(3)21)14(27-10)18-13(15(22)23-4)16-6-17-18/h6,10-12,14H,5H2,1-4H3/t10-,11-,12-,14-/m1/s1
InChI key:InChIKey=HEOMJLCCXYSIGI-HKUMRIAESA-N
SMILES:O(C(C)=O)[C@H]1[C@@H](O[C@H](COC(C)=O)[C@H]1OC(C)=O)N2C(C(OC)=O)=NC=N2
Synonyms:
  • Methyl 1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-5-carboxylate
  • 1H-1,2,4-Triazole-5-carboxylic acid, 1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.