CAS 39930-11-5

2-(3-AMINOPHENYL)PYRIDINE

Description:

2-(3-Aminophenyl)pyridine, with the CAS number 39930-11-5, is an organic compound characterized by the presence of both a pyridine ring and an amino-substituted phenyl group. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, and an amino group (-NH2) attached to the phenyl ring at the meta position relative to the pyridine. The presence of the amino group contributes to its potential as a ligand in coordination chemistry and may enhance its solubility in polar solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Additionally, its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-(3-aminophenyl)pyridine is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₂H₁₂N₂

InChI: InChI=1/C12H12N2/c13-12(10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-9,12H,13H2/p+1/t12-/m1/s1

Synonyms:

• 3-(Pyridin-2-yl)aniline
• Phenyl(Pyridin-2-Yl)Methanamine
• Phenyl(2-Pyridyl)Methanamine
• (S)-phenyl(pyridin-2-yl)methanaminium
• (R)-phenyl(pyridin-2-yl)methanaminium
• α-Phenyl-2-pyridineMethanaMine
• 2-PyridineMethanaMine, α-phenyl

Phenyl(pyridin-2-yl)methanamine

CAS: 39930-11-5

Formula: C₁₂H₁₂N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 184.2371

Ref: IN-DA003A1G

Phenyl(pyridin-2-yl)methanamine

CAS: 39930-11-5

Phenyl(pyridin-2-yl)methanamine

Purity: 97%

Molecular weight: 184.24g/mol

Ref: 54-OR90483

Phenyl(pyridin-2-yl)methanamine

CAS: 39930-11-5

Formula: C₁₂H₁₂N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 184.242

Ref: 10-F093108