CAS 39940-23-3

Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 2,2′,2′′,2′′′-[[(2-hydroxyethyl)imino]bis(2,1-ethanediylnitrilo)]tetrakis[ethanol] (5:1)

Description:

Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 2,2′,2′′,2′′′-[[(2-hydroxyethyl)imino]bis(2,1-ethanediylnitrilo)]tetrakis[ethanol] (5:1), identified by CAS number 39940-23-3, is a complex polyether compound characterized by its polyoxyethylene backbone and multiple hydroxyl functional groups. This substance exhibits hydrophilic properties due to the presence of ethylene oxide units, which enhance its solubility in water and compatibility with various solvents. The incorporation of imino and nitrilo groups suggests potential chelating properties, allowing it to interact with metal ions, which may be beneficial in applications such as catalysis or as a stabilizing agent in formulations. Additionally, the presence of multiple hydroxyl groups indicates that this compound can participate in hydrogen bonding, contributing to its potential use as a surfactant or emulsifier. Overall, its unique structure and functional groups make it suitable for various industrial applications, including pharmaceuticals, cosmetics, and materials science.

Formula: (C₂H₄O)n(C₂H₄O)n(C₂H₄O)n(C₂H₄O)n(C₂H₄O)nC₁₄H₃₃N₃O₅

InChI: InChI=1S/C24H53N3O10/c28-10-20-33-15-5-25(1-3-26(6-16-34-21-11-29)7-17-35-22-12-30)2-4-27(8-18-36-23-13-31)9-19-37-24-14-32/h28-32H,1-24H2

InChI key: InChIKey=FSLMRSVCZBYONR-UHFFFAOYSA-N

SMILES: N(CCN(CCOCCO)CCOCCO)(CCN(CCOCCO)CCOCCO)CCOCCO

Synonyms:

• DETA 20
• DETA 80
• DETA 60
• Polyethylene glycol diethylenetriamine ether
• Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 2,2′,2′′,2′′′-[[(2-hydroxyethyl)imino]bis(2,1-ethanediylnitrilo)]tetrakis[ethanol] (5:1)

Ancamine T

CAS: 39940-23-3

Ancamine T is an amine curing agent, which is derived from synthetic chemical processes, specifically developed for use in epoxy systems. Its mode of action involves catalyzing the cross-linking reaction between epoxide groups in epoxy resins, leading to the formation of a highly cross-linked, thermoset polymer network. This curing process is essential for achieving the desired mechanical, thermal, and chemical resistance properties of the final product.

Purity: Min. 95%

Ref: 3D-FA106515