
CAS 39951-65-0
:8-Chloro-1,2,3,4-tetrahydro-5-methoxy-N,N-dimethyl-1-naphthalenamine
Description:
8-Chloro-1,2,3,4-tetrahydro-5-methoxy-N,N-dimethyl-1-naphthalenamine is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and various functional groups. The presence of a chloro substituent and a methoxy group contributes to its unique reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of the dimethylamino group, which can influence its solubility and interaction with biological systems. The tetrahydro configuration indicates that the compound has a saturated cyclic structure, which may affect its conformational flexibility. Its molecular properties, such as polarity and potential for hydrogen bonding, are influenced by the functional groups attached to the naphthalene core. This compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents, due to its structural features that could interact with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated and amine functionalities.
Formula:C13H18ClNO
InChI:InChI=1S/C13H18ClNO/c1-15(2)11-6-4-5-9-12(16-3)8-7-10(14)13(9)11/h7-8,11H,4-6H2,1-3H3
InChI key:InChIKey=MTWNWMGGMZUIMZ-UHFFFAOYSA-N
SMILES:N(C)(C)C1C=2C(=C(OC)C=CC2Cl)CCC1
Synonyms:- 8-Chloro-1,2,3,4-tetrahydro-5-methoxy-N,N-dimethyl-1-naphthalenamine
- Lometraline
- 1-Naphthalenamine, 8-chloro-1,2,3,4-tetrahydro-5-methoxy-N,N-dimethyl-
- dl-N,N-Dimethyl-5-methoxy-8-chloro-1,2,3,4-tetrahydro-1-naphthylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lometraline
CAS:Lometraline is an investigative aminotetralin derivative.Formula:C13H18ClNOColor and Shape:SolidMolecular weight:239.74
