CAS 3996-29-0

4-Methyl Phenyl Thioacetic

Description:

4-Methyl Phenyl Thioacetic, also known by its IUPAC name, is an organic compound characterized by the presence of a thioacetic acid moiety attached to a para-methylphenyl group. This compound typically exhibits a molecular structure that includes a sulfur atom bonded to a carbon atom of the acetic acid functional group, which contributes to its thioester characteristics. It is generally a colorless to pale yellow liquid with a distinctive odor. The compound is soluble in organic solvents, and its reactivity is influenced by the presence of the thioester functional group, making it susceptible to hydrolysis and nucleophilic attack. 4-Methyl Phenyl Thioacetic may be utilized in various chemical syntheses and applications, particularly in the field of organic chemistry and pharmaceuticals. Safety data indicates that, like many thioesters, it should be handled with care due to potential irritant properties and the need for appropriate safety measures during handling and storage.

Formula: C₉H₉O₂S

InChI: InChI=1/C9H10O2S/c1-7-2-4-8(5-3-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1

SMILES: Cc1ccc(cc1)SCC(=O)[O-]

4-Methylphenylthioacetic acid

CAS: 3996-29-0

Formula: C₉H₁₀OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.2401

Ref: IN-DA003LSH

[(4-Methylphenyl)thio]acetic acid

CAS: 3996-29-0

[(4-Methylphenyl)thio]acetic acid

Formula: C₉H₁₀O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 182.24g/mol

Ref: 54-OR4248

4-Methyl phenyl thioacetic acid

CAS: 3996-29-0

Formula: C₉H₁₀O₂S

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 182.24

Ref: 10-F042198

4-Methyl phenyl thioacetic acid

CAS: 3996-29-0

4-Methyl phenyl thioacetic acid is an organic compound that has been shown to be a competitive inhibitor of the enzyme cinnamate 4-hydroxylase. This enzyme is involved in the production of cinnamic acid derivatives, which are important for the synthesis of many biologically active molecules including peptide hormones and sulfinyl and sulfoxides. 4-Methyl phenyl thioacetic acid binds to the enzyme's active site and prevents it from catalyzing its chemical reaction.

Formula: C₉H₁₀O₂S

Purity: Min. 95%

Molecular weight: 182.24 g/mol

Ref: 3D-DAA99629