CAS 3996-47-2

[(4-chlorophenyl)sulfinyl]acetic acid

Description:

[(4-chlorophenyl)sulfinyl]acetic acid, with the CAS number 3996-47-2, is an organic compound characterized by the presence of a sulfinyl group attached to an acetic acid moiety and a para-chlorophenyl group. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in polar solvents such as water and alcohols, which is common for carboxylic acids. The sulfinyl functional group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. The presence of the chlorophenyl group may enhance its biological activity and influence its interaction with biological systems, making it of interest in pharmaceutical research. Additionally, the compound may exhibit specific properties such as acidity due to the carboxylic acid group, which can donate protons in solution. Overall, [(4-chlorophenyl)sulfinyl]acetic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₈H₇ClO₃S

InChI: InChI=1/C8H7ClO3S/c9-6-1-3-7(4-2-6)13(12)5-8(10)11/h1-4H,5H2,(H,10,11)

SMILES: c1cc(ccc1Cl)S(=O)CC(=O)O

2-(4-Chlorobenzenesulfinyl)acetic acid

CAS: 3996-47-2

Versatile small molecule scaffold

Formula: C₈H₇ClO₃S

Purity: Min. 95%

Molecular weight: 218.66 g/mol

Ref: 3D-DAA99647