CAS 39965-06-5
:2-[(4S,4aS,5S,8S,8aR)-8-methyl-9-methylidene-5-(propan-2-yl)octahydro-4,8-methanoisoquinolin-2(1H)-yl]ethanol
Description:
The chemical substance known as "2-[(4S,4aS,5S,8S,8aR)-8-methyl-9-methylidene-5-(propan-2-yl)octahydro-4,8-methanoisoquinolin-2(1H)-yl]ethanol" with the CAS number 39965-06-5 is a complex organic compound characterized by its unique bicyclic structure, which includes a methanoisoquinoline framework. This compound features multiple stereocenters, contributing to its chiral nature, and exhibits a range of functional groups, including an alcohol group (-OH) and a branched alkyl chain. The presence of the methylidene and isopropyl groups enhances its structural diversity and may influence its reactivity and interactions with biological systems. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. The stereochemistry of the molecule plays a crucial role in determining its biological activity, making it a subject of study in drug design and development. Overall, this substance exemplifies the complexity and richness of organic chemistry, particularly in the context of natural product synthesis and modification.
Formula:C17H29NO
InChI:InChI=1/C17H29NO/c1-11(2)13-5-6-17(4)12(3)14-9-18(7-8-19)10-15(17)16(13)14/h11,13-16,19H,3,5-10H2,1-2,4H3/t13-,14+,15+,16-,17+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Victoxinine
CAS:Victoxinine, the toxic metabolite, considered previously to be a unique product of Helminthosporium victoriae.Formula:C17H29NOPurity:98%Color and Shape:SolidMolecular weight:263.425Victoxinine
CAS:<p>Victoxinine is a synthesized organic compound designed specifically as a potent antioxidant, which is derived from advanced combinatorial chemistry techniques involving naturally occurring polyphenolic precursors. The mode of action for Victoxinine involves scavenging free radicals, thereby reducing oxidative stress within biological systems. It achieves this by donating electrons to unstable molecules, effectively neutralizing them and preventing potential cellular damage.</p>Formula:C17H29NOPurity:Min. 95%Molecular weight:263.40 g/mol

