CAS 39974-94-2

5-Methoxy-1-methylindole-3-carboxaldehyde

Description:

5-Methoxy-1-methylindole-3-carboxaldehyde is an organic compound belonging to the indole family, characterized by its indole structure with a methoxy group and a carboxaldehyde functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to biologically active compounds. The presence of the methoxy group can influence its solubility and reactivity, while the aldehyde group may participate in various chemical reactions, such as condensation and oxidation. Additionally, this compound may exhibit interesting biological activities, making it a subject of research in fields like neurochemistry and pharmacology. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3

SMILES: Cn1cc(C=O)c2cc(ccc12)OC

Synonyms:

• 3-Formyl-5-methoxy-1-methylindole
• 5-methoxy-1-methyl-1H-indole-3-carbaldehyde

5-Methoxy-1-methyl-1H-indole-3-carbaldehyde

CAS: 39974-94-2

Formula: C₁₁H₁₁NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 189.2105

Ref: IN-DA003MTW

5-Methoxy-1-methyl-1H-indole-3-carboxaldehyde

CAS: 39974-94-2

5-Methoxy-1-methyl-1H-indole-3-carboxaldehyde

Formula: C₁₁H₁₁NO₂

Purity: ≥95%

Color and Shape: dark orange. crystalline solid

Molecular weight: 189.21g/mol

Ref: 54-OR110442

5-Methoxy-1-methyl-1H-indole-3-carbaldehyde

CAS: 39974-94-2

Formula: C₁₁H₁₁NO₂

Purity: 96%

Molecular weight: 189.214

Ref: 10-F321929

5-Methoxy-1-methyl-1H-indole-3-carbaldehyde

CAS: 39974-94-2

5-Methoxy-1-methyl-1H-indole-3-carbaldehyde is a synthetic compound that has been shown to inhibit the growth of human tumour cells in vitro. This compound is a regioisomeric mixture of two enantiomers, with the (S) isomer being the more potent inhibitor. The (R) isomer was found to be less active against human tumour cells and may have an antimicrobial activity. 5-Methoxy-1-methyl-1H-indole-3-carbaldehyde has been shown to be bioreductive towards electron donors such as NADPH and glutathione. It also inhibits dt diaphorase and aerobic metabolism in human tumour cells.

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 189.21 g/mol

Ref: 3D-FM117680