CAS 39978-18-2
:2-(thiophen-2-yl)acetohydrazide
Description:
2-(Thiophen-2-yl)acetohydrazide is an organic compound characterized by the presence of both a thiophene ring and a hydrazide functional group. This compound typically exhibits a molecular structure that includes a thiophene moiety, which contributes to its aromatic properties and potential for engaging in π-π interactions. The acetohydrazide portion of the molecule introduces a hydrazine functional group, which is known for its reactivity and ability to form various derivatives. This compound may display moderate solubility in polar solvents due to the presence of the hydrazide group, while the thiophene ring can enhance its lipophilicity. Additionally, 2-(thiophen-2-yl)acetohydrazide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its reactivity can be attributed to the presence of the hydrazide functional group, which can participate in condensation reactions and form hydrazones with carbonyl compounds. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C6H8N2OS
InChI:InChI=1/C6H8N2OS/c7-8-6(9)4-5-2-1-3-10-5/h1-3H,4,7H2,(H,8,9)
SMILES:c1cc(CC(=NN)O)sc1
Synonyms:- 2-(2-Thienyl)acetohydrazide
- 2-Thiopheneacetic acid, hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Thien-2-ylacetohydrazide
CAS:2-Thien-2-ylacetohydrazide is a triazole that inhibits the bacterial enzyme butyrylcholinesterase, which is involved in the degradation of acetylcholine. This drug has been shown to be effective against Escherichia coli and Pseudomonas aeruginosa, as well as bacteriophage P. pyogenes and Staphylococcus aureus. 2-Thien-2-ylacetohydrazide is an alkylating agent that reacts with chloride ions to form chloramines, which are highly reactive with DNA and RNA. It also has been shown to inhibit the growth of bacteria in an aerobic environment. The molecular weight of 2-thien-2-ylacetohydrazide is 284 Da, and it crystallizes in space group P21/n with one molecule per asymmetric unit.Formula:C6H8N2OSPurity:Min. 95%Molecular weight:156.21 g/mol

