CAS 39984-17-3
:Dopaminochrome
Description:
Dopaminochrome is a chemical compound that arises from the oxidation of dopamine, a neurotransmitter involved in various physiological functions. It is characterized by its unique structure, which includes a chromone moiety, contributing to its distinct chemical properties. Dopaminochrome is known for its potential role in neurochemistry and has been studied for its implications in neurodegenerative diseases and psychiatric disorders. The compound exhibits redox activity, which can influence its reactivity and interactions with biological molecules. Additionally, dopaminochrome can undergo further transformations, leading to the formation of other derivatives. Its solubility and stability can vary depending on the pH and the presence of other ions or molecules in the environment. Research into dopaminochrome continues to explore its biological significance, particularly in relation to oxidative stress and its potential neuroprotective or neurotoxic effects. Understanding its characteristics is crucial for elucidating its role in both normal physiology and pathological conditions.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,11H,1-2H2
InChI key:InChIKey=KAZWRYIEJRERSG-UHFFFAOYSA-N
SMILES:O=C1C=C2C(C=C1O)=NCC2
Synonyms:- 1H-Indole-5,6-dione, 2,3-dihydro-
- 2,3-Dihydro-6-hydroxy-5H-indol-5-one
- 5H-Indol-5-one, 2,3-dihydro-6-hydroxy-
- Aminochrome
- Aminochrome 1
- Dopaminochrome
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Dopaminechrome
CAS:Dopaminechrome (DACHR) is an oxidation product of dopamine that promotes the generation of H2O2 at mitochondrial complex I in the brain in a concentration- and respiration-dependent manner. It possesses neurotoxic properties and can be utilized in Parkinson's disease research.
Formula:C8H7NO2Color and Shape:SolidMolecular weight:149.147Ref: 4Z-A-235001
Discontinued product


