CAS 39987-25-2
:dimethyl iminodiacetate hydrochloride
Description:
Dimethyl iminodiacetate hydrochloride is a chemical compound characterized by its structure, which includes two acetic acid moieties and an imino group. It is typically encountered as a white to off-white crystalline solid that is soluble in water and various organic solvents. The compound is often used in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of amides and other nitrogen-containing compounds. Its hydrochloride form indicates the presence of a hydrochloric acid moiety, which can enhance its solubility and stability in aqueous solutions. Dimethyl iminodiacetate hydrochloride may exhibit properties such as moderate toxicity, and appropriate safety measures should be taken when handling it. Additionally, it can participate in various biochemical processes, making it of interest in pharmaceutical and medicinal chemistry. As with any chemical, proper storage and handling protocols should be followed to ensure safety and maintain its integrity.
Formula:C6H12ClNO4
InChI:InChI=1/C6H11NO4.ClH/c1-10-5(8)3-7-4-6(9)11-2;/h7H,3-4H2,1-2H3;1H
SMILES:COC(=O)CNCC(=O)OC.Cl
Synonyms:- Dimethyl 2,2'-Iminodiacetate
- Dimethyl 2,2'-Iminodiacetate Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dimethyl iminodiacetate hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H12ClNO4Purity:98%Color and Shape:White, PowderMolecular weight:197.62Dimethyl 2,2'-azanediyldiacetate hydrochloride
CAS:Formula:C6H12ClNO4Purity:95%Color and Shape:SolidMolecular weight:197.6168Dimethyl 2,2’-Azanediyldiacetate Hydrochloride
CAS:Dimethyl 2,2’-Azanediyldiacetate HydrochloridePurity:97%Molecular weight:197.62g/molDimethyl 2,2′-azanediyldiacetate hydrochloride
CAS:Formula:C6H12ClNO4Purity:95%Color and Shape:SolidMolecular weight:197.62Dimethyl Iminodiacetate Hydrochloride
CAS:Formula:C6H11NO4·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:197.62Dimethyl iminodiacetate hydrochloride
CAS:Controlled ProductFormula:C6H12ClNO4Color and Shape:NeatMolecular weight:197.62





