
CAS 39989-43-0
:3,5-Dichlorobenzylamine
Description:
3,5-Dichlorobenzylamine is an organic compound characterized by its structure, which features a benzene ring substituted with two chlorine atoms at the 3 and 5 positions and an amine group (-NH2) attached to a benzyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many chlorinated aromatic compounds. 3,5-Dichlorobenzylamine exhibits basic properties due to the presence of the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is often used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Safety considerations include handling it with care, as it may be harmful if inhaled or ingested, and appropriate personal protective equipment should be used to minimize exposure.
Formula:C7H7Cl2N
InChI:InChI=1/C7H7Cl2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H,4,10H2
SMILES:c1c(cc(cc1Cl)Cl)CN
Synonyms:- Benzenemethanamine, 3,5-dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dichlorobenzylamine, 94%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7Cl2NPurity:94%Color and Shape:Liquid, Clear colorless to yellowMolecular weight:176.053,5-Dichlorobenzylamine
CAS:Formula:C7H7Cl2NPurity:95%Color and Shape:Liquid, ClearMolecular weight:176.043,5-DICHLOROBENZYLAMINE
CAS:Formula:C7H7Cl2NPurity:95%Color and Shape:LiquidMolecular weight:176.04323,5-Dichlorobenzylamine
CAS:3,5-DichlorobenzylamineFormula:C7H7Cl2NPurity:techColor and Shape: clear. yellow liquidMolecular weight:176.04g/mol



