CymitQuimica logo

CAS 400-23-7

:

2-Nitro-4-(trifluoromethylsulfonyl)aniline

Description:
2-Nitro-4-(trifluoromethylsulfonyl)aniline, with the CAS number 400-23-7, is an organic compound characterized by the presence of both nitro and trifluoromethylsulfonyl functional groups attached to an aniline structure. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the electron-withdrawing groups. The nitro group contributes to its reactivity, making it a useful intermediate in various chemical syntheses. The trifluoromethylsulfonyl group enhances its lipophilicity and stability, which can influence its behavior in biological systems. Additionally, this compound may exhibit specific solubility characteristics in organic solvents, and its reactivity can be modulated by the presence of the electron-withdrawing groups. Safety considerations should be taken into account when handling this substance, as it may pose health risks, including toxicity. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C7H5F3N2O4S
InChI:InChI=1/C7H5F3N2O4S/c8-7(9,10)17(15,16)4-1-2-5(11)6(3-4)12(13)14/h1-3H,11H2
InChI key:FKMFQWURIVAFGN-UHFFFAOYSA-N
SMILES:c1cc(c(cc1S(=O)(=O)C(F)(F)F)N(=O)=O)N
Found 2 products.