CAS 400-31-7
:1,1,1-trifluoro-4-methylpent-3-en-2-one
Description:
1,1,1-Trifluoro-4-methylpent-3-en-2-one, with the CAS number 400-31-7, is an organic compound characterized by its unique trifluoromethyl and enone functional groups. This compound features a pentene backbone, which contributes to its unsaturation and reactivity. The presence of three fluorine atoms significantly influences its physical and chemical properties, enhancing its polarity and making it a useful intermediate in various chemical syntheses. Typically, it appears as a colorless liquid with a distinctive odor. Its boiling point and solubility characteristics are influenced by the trifluoromethyl group, which can also affect its reactivity in nucleophilic addition reactions. Additionally, this compound is of interest in the field of medicinal chemistry and materials science due to its potential applications in the synthesis of fluorinated compounds and agrochemicals. Safety precautions should be observed when handling this substance, as it may pose health risks upon exposure. Overall, 1,1,1-trifluoro-4-methylpent-3-en-2-one is a versatile compound with significant implications in various chemical research areas.
Formula:C6H7F3O
InChI:InChI=1/C6H7F3O/c1-4(2)3-5(10)6(7,8)9/h3H,1-2H3
SMILES:CC(=CC(=O)C(F)(F)F)C
Synonyms:- 1,1,1-trifluoro-4-methylpent-3-en-2-one(WXC08489)
- 1,1,1-trifluoro-4-methyl-3-pentene-2-one
- 3-Penten-2-one, 1,1,1-trifluoro-4-methyl-
- 1,1,1-trifluoro-4-methylpent-3-en-2-one
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.