CymitQuimica logo

CAS 400073-97-4

:

1-Methyl-5-(4-methylphenoxy)-3-(trifluoromethyl)-1H-pyrazole-4-methanol

Description:
1-Methyl-5-(4-methylphenoxy)-3-(trifluoromethyl)-1H-pyrazole-4-methanol, with CAS number 400073-97-4, is a chemical compound characterized by its pyrazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group at the 1-position and a trifluoromethyl group at the 3-position, contributing to its unique electronic properties and potential biological activity. The presence of a 4-methylphenoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. Additionally, the hydroxymethyl group at the 4-position of the pyrazole ring can participate in hydrogen bonding, potentially affecting its reactivity and interactions with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in agrochemicals or pharmaceuticals, although specific biological activities would require further investigation through experimental studies.
Formula:C13H13F3N2O2
InChI:InChI=1S/C13H13F3N2O2/c1-8-3-5-9(6-4-8)20-12-10(7-19)11(13(14,15)16)17-18(12)2/h3-6,19H,7H2,1-2H3
InChI key:InChIKey=NUYMWXXBSBICJO-UHFFFAOYSA-N
SMILES:C(O)C1=C(OC2=CC=C(C)C=C2)N(C)N=C1C(F)(F)F
Synonyms:
  • 1-Methyl-5-(4-methylphenoxy)-3-(trifluoromethyl)-1H-pyrazole-4-methanol
  • 1H-Pyrazole-4-methanol, 1-methyl-5-(4-methylphenoxy)-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.