CAS 400079-79-0
:3-Acetyl-4-methoxy-2(1H)-quinolinone
Description:
3-Acetyl-4-methoxy-2(1H)-quinolinone, with the CAS number 400079-79-0, is a synthetic organic compound belonging to the quinolinone class. This compound features a quinoline backbone, which is characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. The presence of an acetyl group at the 3-position and a methoxy group at the 4-position contributes to its unique chemical properties. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, the presence of functional groups such as the methoxy and acetyl groups can influence its reactivity and stability, making it a subject of study in organic synthesis and drug development. As with many quinolinone derivatives, it may also exhibit fluorescence properties, which can be useful in analytical applications.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-7(14)10-11(16-2)8-5-3-4-6-9(8)13-12(10)15/h3-6H,1-2H3,(H,13,15)
InChI key:InChIKey=QGMICPWQCVLUIG-UHFFFAOYSA-N
SMILES:O(C)C=1C=2C(NC(=O)C1C(C)=O)=CC=CC2
Synonyms:- 3-Acetyl-4-methoxy-2(1H)-quinolinone
- 3-Acetyl-4-methoxy-1,2-dihydroquinolin-2-one
- 2(1H)-Quinolinone, 3-acetyl-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Acetyl-4-methoxy-1,2-dihydroquinolin-2-one
CAS:<p>3-Acetyl-4-methoxy-1,2-dihydroquinolin-2-one</p>Purity:techMolecular weight:217.22g/mol
