
CAS 400091-05-6
:4-methoxyphenyl 4,6-O-(phenylmethylidene)-3-O-prop-2-en-1-yl-beta-D-galactopyranoside
Description:
4-Methoxyphenyl 4,6-O-(phenylmethylidene)-3-O-prop-2-en-1-yl-beta-D-galactopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a galactopyranoside moiety linked to a phenylmethylidene group and a prop-2-en-1-yl substituent. This compound features a methoxy group that enhances its solubility and reactivity. The presence of the phenylmethylidene group contributes to its potential as a ligand in various chemical reactions, while the prop-2-en-1-yl group may facilitate further transformations, such as polymerization or cross-linking. The compound's structure suggests potential applications in fields such as medicinal chemistry, where it may exhibit biological activity due to its glycosidic nature. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it a candidate for further synthetic modifications. Its CAS number, 400091-05-6, provides a unique identifier for researchers seeking to locate specific data or studies related to this compound.
Formula:C23H26O7
InChI:InChI=1/C23H26O7/c1-3-13-26-21-19(24)23(28-17-11-9-16(25-2)10-12-17)29-18-14-27-22(30-20(18)21)15-7-5-4-6-8-15/h3-12,18-24H,1,13-14H2,2H3/t18-,19-,20+,21-,22+,23-/m1/s1
Sort by
Found 4 products.
4-Methoxyphenyl 3-O-Allyl-4,6-O-benzylidene-β-D-galactopyranoside
CAS:Formula:C23H26O7Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:414.45Ref: 3B-M1589
1g97.00€5g267.00€4-Methoxyphenyl 3-O-allyl-4,6-O-benzylidene-β-D-galactopyranoside
CAS:4-Methoxyphenyl 3-O-allyl-4,6-O-benzylidene-b-D-galactopyranoside is a galactoside that is commonly found in plants. The biosynthesis of this molecule has been studied in the bacteria N. meningitidis and it has been shown that it can be synthesized from fatty acids. 4-Methoxyphenyl 3-O-allyl-4,6-O-benzylidene b -D -galactopyranoside can be used as a HIV drug, as it inhibits the growth of HIV cells by inhibiting protein synthesis and RNA transcription. This molecule is also able to inhibit cancer cell proliferation in vitro.Formula:C23H26O7Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:414.45 g/molRef: 3D-MM07050
1g168.00€500mg135.00€(4AR,6S,7R,8R,8aS)-8-(allyloxy)-6-(4-methoxyphenoxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxin-7-ol
CAS:Formula:C23H26O7Purity:98%Molecular weight:414.4483Ref: IN-DA003LOD
1g160.00€5g651.00€250mg102.00€