CymitQuimica logo

CAS 400091-05-6

:

4-methoxyphenyl 4,6-O-(phenylmethylidene)-3-O-prop-2-en-1-yl-beta-D-galactopyranoside

Description:
4-Methoxyphenyl 4,6-O-(phenylmethylidene)-3-O-prop-2-en-1-yl-beta-D-galactopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a galactopyranoside moiety linked to a phenylmethylidene group and a prop-2-en-1-yl substituent. This compound features a methoxy group that enhances its solubility and reactivity. The presence of the phenylmethylidene group contributes to its potential as a ligand in various chemical reactions, while the prop-2-en-1-yl group may facilitate further transformations, such as polymerization or cross-linking. The compound's structure suggests potential applications in fields such as medicinal chemistry, where it may exhibit biological activity due to its glycosidic nature. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it a candidate for further synthetic modifications. Its CAS number, 400091-05-6, provides a unique identifier for researchers seeking to locate specific data or studies related to this compound.
Formula:C23H26O7
InChI:InChI=1/C23H26O7/c1-3-13-26-21-19(24)23(28-17-11-9-16(25-2)10-12-17)29-18-14-27-22(30-20(18)21)15-7-5-4-6-8-15/h3-12,18-24H,1,13-14H2,2H3/t18-,19-,20+,21-,22+,23-/m1/s1
Sort by

Found 4 products.