CAS 40010-20-6
:4-fluoro-4-deoxy-D-galactopyranose
Description:
4-Fluoro-4-deoxy-D-galactopyranose is a monosaccharide derivative of galactose, characterized by the substitution of a fluorine atom at the 4-position of the sugar ring. This modification results in the loss of the hydroxyl group typically found at that position, hence the term "deoxy." The presence of the fluorine atom can significantly influence the compound's chemical properties, such as its reactivity, stability, and interaction with biological systems. As a pyranose, it adopts a six-membered ring structure, which is common among many sugars. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug design and as a biochemical probe. Its unique properties may affect its solubility, metabolic pathways, and biological activity compared to its non-fluorinated counterparts. Overall, 4-fluoro-4-deoxy-D-galactopyranose exemplifies how small modifications in molecular structure can lead to significant changes in chemical behavior and biological function.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-3-2(1-8)12-6(11)5(10)4(3)9/h2-6,8-11H,1H2/t2-,3+,4+,5-,6?/m1/s1
Synonyms:- 4-deoxy-4-fluoro-D-galactopyranose
- 4-FLUORO-4-DEOXY-D-GALACTOPYRANOSE
- 4-DEOXY-4-FLUORO-D-GALACTOSE
- 4-Fluoro-4-deoxy-D-galactopyranose97%
- (3R,4R,5R,6R)-5-Fluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4-triol
- 4-Fluoro-4-deoxy-D-galactopyranose 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-4-deoxy-D-galactopyranose
CAS:4-Fluoro-4-deoxy-D-galactopyranosePurity:97%Molecular weight:182.15g/mol4-Deoxy-4-fluoro-D-galactose
CAS:Controlled ProductFormula:C6H11FO5Color and Shape:NeatMolecular weight:182.154-Deoxy-4-fluoro-D-galactose
CAS:<p>4-Deoxy-4-fluoro-D-galactose (FUDG) is a modification of the sugar galactose. It is an inhibitor of glucosyltransferases, and it is used in the synthesis of oligosaccharides. FUDG has been shown to be a substrate for recombinant proteins that bind to 2-deoxy-2-fluoro-d-mannose, which are involved in the regulation of blood group expression. The binding affinity and specificity of FUDG for these proteins was examined using electrophysiology techniques. These results may help to rationalize how FUDG binds to these proteins and its potential as a glucose sensor.</p>Formula:C6H11FO5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:182.15 g/mol



