CAS 40019-27-0

3,5-Diethyl 1,2,4-oxadiazole-3,5-dicarboxylate

Description:

3,5-Diethyl 1,2,4-oxadiazole-3,5-dicarboxylate is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features two ethyl groups attached to the 3 and 5 positions of the oxadiazole ring, contributing to its hydrophobic properties. The presence of dicarboxylate functional groups at the 3 and 5 positions enhances its reactivity, making it useful in various chemical syntheses and applications. Typically, compounds of this nature exhibit moderate to high thermal stability and can participate in diverse chemical reactions, including esterification and nucleophilic substitutions. The oxadiazole moiety is known for its potential biological activity, which may include antimicrobial or anti-inflammatory properties. Additionally, the compound's solubility in organic solvents can facilitate its use in organic synthesis and material science. As with many chemical substances, safety precautions should be observed when handling, as the specific toxicity and environmental impact may vary.

Formula: C₈H₁₀N₂O₅

InChI: InChI=1S/C8H10N2O5/c1-3-13-7(11)5-9-6(15-10-5)8(12)14-4-2/h3-4H2,1-2H3

InChI key: InChIKey=DCDJUSBZFZRZSB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(C(OCC)=O)ON1

Synonyms:

• 3,5-Diethyl 1,2,4-oxadiazole-3,5-dicarboxylate
• 1,2,4-Oxadiazole-3,5-dicarboxylic acid, diethyl ester
• 1,2,4-Oxadiazole-3,5-dicarboxylic acid, 3,5-diethyl ester