CAS 4002-81-7

4,5-Dibromo-2-methylimidazole

Description:

4,5-Dibromo-2-methylimidazole is a heterocyclic organic compound characterized by its imidazole ring, which contains two bromine substituents at the 4 and 5 positions and a methyl group at the 2 position. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure contributes to its reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. The presence of bromine atoms enhances its electrophilic properties, allowing it to participate in nucleophilic substitution reactions. Additionally, the imidazole ring is known for its biological significance, often found in various biomolecules, including amino acids and nucleotides. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose health risks. Overall, 4,5-Dibromo-2-methylimidazole is a valuable compound in both research and industrial settings due to its unique chemical properties.

Formula: C₄H₄Br₂N₂

InChI: InChI=1/C4H4Br2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8)

SMILES: Cc1nc(c(Br)[nH]1)Br

Synonyms:

• 4,5-dibromo-2-methyl-1H-imidazole
• 1H-Imidazole, 4,5-dibromo-2-methyl-
• 4,5-DIBROMO-2-METHYLIMIDAZOLE

4,5-Dibromo-2-methylimidazole

CAS: 4002-81-7

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.8960

Ref: IN-DA00BXKD

4,5-Dibromo-2-methylimidazole

CAS: 4002-81-7

4,5-Dibromo-2-methylimidazole

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 239.90g/mol

Ref: 54-OR10437

4,5-Dibromo-2-methylimidazole

CAS: 4002-81-7

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.898

Ref: 10-F227885