CAS 40020-06-2
:4,6-Dibromo-3-phenylpyridazine
Description:
4,6-Dibromo-3-phenylpyridazine is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with bromine atoms and a phenyl group. This compound typically exhibits a pale to dark solid appearance, depending on its purity and form. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity, making it useful in electrophilic substitution reactions. Additionally, the phenyl group contributes to its aromatic properties, which can influence its solubility and stability in different solvents. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4,6-Dibromo-3-phenylpyridazine is a versatile compound with significant implications in chemical research and industry.
Formula:C10H6Br2N2
InChI:InChI=1S/C10H6Br2N2/c11-8-6-9(12)13-14-10(8)7-4-2-1-3-5-7/h1-6H
InChI key:InChIKey=LINXZJNHOAOKNW-UHFFFAOYSA-N
SMILES:BrC1=C(C2=CC=CC=C2)N=NC(Br)=C1
Synonyms:- 4,6-Dibromo-3-phenylpyridazine
- 4,6-Dibromo-3-phenylpyridazine
- Pyridazine, 4,6-dibromo-3-phenyl-
- 3-Phenyl-4,6-dibromopyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
