CAS 40023-02-7
:2-chloro-N-(3-methoxybenzyl)acetamide
Description:
2-Chloro-N-(3-methoxybenzyl)acetamide is an organic compound characterized by its acetamide functional group, which is substituted with a chloro group and a methoxybenzyl moiety. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy group, attached to the benzyl ring, enhances the compound's solubility in organic solvents and may also affect its biological activity. This compound typically exhibits moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of nucleophiles or electrophiles due to the functional groups present. It may be used in various chemical syntheses or as an intermediate in pharmaceutical development, given its structural features that can interact with biological targets. Additionally, the compound's molecular structure suggests potential for hydrogen bonding, which could impact its physical properties such as melting point and solubility. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C10H12ClNO2
InChI:InChI=1/C10H12ClNO2/c1-14-9-4-2-3-8(5-9)7-12-10(13)6-11/h2-5H,6-7H2,1H3,(H,12,13)
SMILES:COc1cccc(c1)CN=C(CCl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

