CAS 40023-03-8
:N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide
Description:
N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide, with the CAS number 40023-03-8, is a chemical compound that features a benzodioxole moiety, which is known for its presence in various bioactive compounds. This substance typically exhibits characteristics such as being a white to off-white solid at room temperature. It is soluble in organic solvents, which is common for compounds containing aromatic rings and halogen substituents. The presence of the chloroacetamide functional group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may also exhibit biological activity, as many derivatives of benzodioxole are known for their pharmacological properties. Its structure indicates potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C10H10ClNO3
InChI:InChI=1S/C10H10ClNO3/c11-4-10(13)12-5-7-1-2-8-9(3-7)15-6-14-8/h1-3H,4-6H2,(H,12,13)
InChI key:InChIKey=PLXGAUGZSOPIIG-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C=1C=C2C(=CC1)OCO2
Synonyms:- N-(1,3-Benzodioxol-5-ylmethyl)-2-chloroacetamide
- Acetamide, N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-
- N-[(Benzodioxol-5-yl)methyl]-2-chloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
