CAS 40023-34-5

2-chloro-N-(1-phenylbutyl)acetamide

Description:

2-Chloro-N-(1-phenylbutyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of a chloro substituent indicates that it contains a chlorine atom, which can influence its reactivity and solubility. The compound features a phenyl group attached to a butyl chain, contributing to its hydrophobic characteristics. This structure may affect its biological activity and interactions with other molecules. The molecular formula typically includes carbon, hydrogen, chlorine, and nitrogen atoms, reflecting its complex structure. As a chemical entity, it may exhibit specific properties such as melting and boiling points, solubility in various solvents, and potential applications in pharmaceuticals or agrochemicals. Its CAS number, 40023-34-5, serves as a unique identifier for regulatory and safety information. Overall, the characteristics of 2-chloro-N-(1-phenylbutyl)acetamide make it a compound of interest in various chemical and biological research fields.

Formula: C₁₂H₁₆ClNO

InChI: InChI=1/C12H16ClNO/c1-2-6-11(14-12(15)9-13)10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3,(H,14,15)

SMILES: CCCC(c1ccccc1)N=C(CCl)O

2-Chloro-N-(1-phenylbutyl)acetamide

CAS: 40023-34-5

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO

Purity: Min. 95%

Molecular weight: 225.71 g/mol

Ref: 3D-QBA02334