CAS 40027-64-3

3,5-dimethyl-1H-pyrazole-1-carboximidamide hydrochloride (1:1)

Description:

3,5-Dimethyl-1H-pyrazole-1-carboximidamide hydrochloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 3 and 5 positions of the pyrazole ring, contributing to its unique properties. The carboximidamide functional group indicates the presence of an amidine, which is known for its basicity and ability to form hydrogen bonds, enhancing its reactivity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. This compound is of interest in various fields, including medicinal chemistry and agricultural chemistry, due to its potential biological activities. Its CAS number, 40027-64-3, allows for precise identification in chemical databases. Overall, 3,5-dimethyl-1H-pyrazole-1-carboximidamide hydrochloride exhibits characteristics typical of pyrazole derivatives, including potential applications in drug development and as a research tool in biochemical studies.

Formula: C₇H₁₃ClN₄

InChI: InChI=1/C7H12N4.ClH/c1-4-5(2)10-11(6(4)3)7(8)9;/h1-3H3,(H3,8,9);1H

SMILES: Cc1c(C)nn(c1C)C(=N)N.Cl

Synonyms:

• 1H-pyrazole-1-carboximidamide, 3,5-dimethyl-, hydrochloride (1:1)
• 3,4,5-trimethyl-1H-pyrazole-1-carboximidamide hydrochloride
• 3,5-Dimethyl-1H-pyrazole-1-carboximidamide hydrochloride (1:1)

3,5-Dimethyl-1H-pyrazole-1-carboxamidine hydrochloride

CAS: 40027-64-3

Formula: C₆H₁₁ClN₄

Purity: 95%

Molecular weight: 174.6313

Ref: IN-DA0033JO

3,5-Dimethyl-1H-pyrazole-1-carboximidamide hydrochloride

CAS: 40027-64-3

3,5-Dimethyl-1H-pyrazole-1-carboximidamide hydrochloride

Purity: 95%

Molecular weight: 174.63g/mol

Ref: 54-OR1064901

3,5-Dimethylpyrazole-1-carboximidamide hydrochloride

CAS: 40027-64-3

3,5-Dimethylpyrazole-1-carboximidamide hydrochloride is a test compound that can be used in enzyme preparations. It inhibits glyoxalase, which is an enzyme that catalyzes the reaction of glyoxal and lysine residues, preventing the formation of advanced glycation end products. 3,5-Dimethylpyrazole-1-carboximidamide hydrochloride has been shown to be a potent inhibitor of vesicular stomatitis virus (VSV) replication with high specificity for the aminoguanidine (AGA) site on VSV RNA polymerase. The mechanism for this inhibition is not fully understood; however, it is thought to involve the primary amines on 3,5-dimethylpyrazole-1-carboximidamide hydrochloride reacting with lysine residues on VSV RNA polymerase. This binding prevents amino acid activation and subsequent incorporation into the growing viral

Formula: C₆H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 174.63 g/mol

Ref: 3D-QBA02764