CAS 40027-70-1
:N,N,7-trimethylguanosine
Description:
N,N,7-trimethylguanosine is a modified nucleoside that plays a significant role in various biological processes, particularly in RNA metabolism. It is characterized by the presence of a guanine base attached to a ribose sugar, which is further modified by three methyl groups: two on the nitrogen atoms at positions N-2 and N-7 of the guanine, and one on the nitrogen atom of the ribose. This methylation enhances the stability of RNA molecules and is crucial for the proper functioning of ribonucleoproteins. N,N,7-trimethylguanosine is often found in the cap structure of eukaryotic mRNA, which is essential for mRNA stability, nuclear export, and translation initiation. The presence of this modified nucleoside can influence the interaction of RNA with various proteins and other biomolecules, thereby playing a vital role in gene expression regulation. Its CAS number, 40027-70-1, is a unique identifier that facilitates the cataloging and study of this compound in scientific literature and databases.
Formula:C13H20N5O5
InChI:InChI=1/C13H19N5O5/c1-16(2)13-14-10-7(11(22)15-13)17(3)5-18(10)12-9(21)8(20)6(4-19)23-12/h5-6,8-9,12,19-21H,4H2,1-3H3/p+1/t6-,8-,9-,12-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-(dimethylamino)-7-methyl-1,7,8,9-tetrahydro-6H-purin-6-one
CAS:Formula:C13H21N5O5Purity:95%Color and Shape:SolidMolecular weight:327.3363N2,N2,7-Trimethylguanosine
CAS:Formula:C13H20N5O5Purity:≥ 95.0%Color and Shape:White to off-white solidMolecular weight:326.33N2,N2,N7-Trimethyl guanosine
CAS:<p>Nucleoside Derivatives - 2--Modified purine nucleosides; N-Alkylated nucleosides; Naturally modified ribo-nucleosides</p>Formula:C13H20N5O5Color and Shape:SolidMolecular weight:326.33N2,N2,7-Trimethylguanosine
CAS:<p>Trimethylguanosine is a hydrogen-bonded base that is found in the DNA of all living organisms. It has a diagnostic role in cancer and metabolic disorders, as well as in the study of cell culture. Trimethylguanosine can be used to identify cancer cells by measuring its fluorescence properties, which are different from those of healthy cells. This compound also has a role in the diagnosis of metabolic disorders, such as diabetes mellitus and renal disease. Trimethylguanosine is also involved in biological function, and is necessary for the synthesis of proteins and nucleic acids.</p>Formula:C13H20N5O5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:326.33 g/mol



